C11H21F2NO2 — CID 166971903
tert-butyl N-(3,5-difluorohexan-2-yl)carbamate (PubChem CID 166971903) has the molecular formula C11H21F2NO2 and a molecular weight of 237.29 g/mol. Its IUPAC name is tert-butyl N-(3,5-difluorohexan-2-yl)carbamate.
| Compound Name | tert-butyl N-(3,5-difluorohexan-2-yl)carbamate |
|---|---|
| PubChem CID | 166971903 |
| Molecular Formula | C11H21F2NO2 |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | tert-butyl N-(3,5-difluorohexan-2-yl)carbamate |
| SMILES | CC(F)CC(F)C(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H21F2NO2/c1-7(12)6-9(13)8(2)14-10(15)16-11(3,4)5/h7-9H,6H2,1-5H3,(H,14,15) |
| InChIKey | DXKHSTMWEDHTAL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |