C8H17NO4 — CID 51898096
tert-butyl N-[(1R)-2-hydroxy-1-methoxyethyl]carbamate (PubChem CID 51898096) has the molecular formula C8H17NO4 and a molecular weight of 191.23 g/mol. Its IUPAC name is tert-butyl N-[(1R)-2-hydroxy-1-methoxyethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-2-hydroxy-1-methoxyethyl]carbamate |
|---|---|
| PubChem CID | 51898096 |
| Molecular Formula | C8H17NO4 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | tert-butyl N-[(1R)-2-hydroxy-1-methoxyethyl]carbamate |
| SMILES | CO[C@H](CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C8H17NO4/c1-8(2,3)13-7(11)9-6(5-10)12-4/h6,10H,5H2,1-4H3,(H,9,11)/t6-/m1/s1 |
| InChIKey | WOUPEUOOKULCDC-ZCFIWIBFSA-N |
| XLogP | 0.48 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|