C9H17NO5 — CID 89296265
[3-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] formate (PubChem CID 89296265) has the molecular formula C9H17NO5 and a molecular weight of 219.24 g/mol. Its IUPAC name is [3-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] formate.
| Compound Name | [3-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] formate |
|---|---|
| PubChem CID | 89296265 |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | [3-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] formate |
| SMILES | CC(C)(C)OC(=O)NC(CCO)OC=O |
| InChI | InChI=1S/C9H17NO5/c1-9(2,3)15-8(13)10-7(4-5-11)14-6-12/h6-7,11H,4-5H2,1-3H3,(H,10,13) |
| InChIKey | UJOUROHGIODHPP-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|