C11H21NO4 — CID 85230878
tert-butyl N-[3-hydroxy-1-(1-hydroxycyclopropyl)propyl]carbamate (PubChem CID 85230878) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is tert-butyl N-[3-hydroxy-1-(1-hydroxycyclopropyl)propyl]carbamate.
| Compound Name | tert-butyl N-[3-hydroxy-1-(1-hydroxycyclopropyl)propyl]carbamate |
|---|---|
| PubChem CID | 85230878 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | tert-butyl N-[3-hydroxy-1-(1-hydroxycyclopropyl)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCO)C1(O)CC1 |
| InChI | InChI=1S/C11H21NO4/c1-10(2,3)16-9(14)12-8(4-7-13)11(15)5-6-11/h8,13,15H,4-7H2,1-3H3,(H,12,14) |
| InChIKey | IUFYAZDODBUYBE-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |