C15H27NO6 — CID 25231925
[(E,5R,7R)-5-hydroxy-7-[(2-methylpropan-2-yl)oxycarbonylamino]oct-2-enyl] methyl carbonate (PubChem CID 25231925) has the molecular formula C15H27NO6 and a molecular weight of 317.38 g/mol. Its IUPAC name is [(E,5R,7R)-5-hydroxy-7-[(2-methylpropan-2-yl)oxycarbonylamino]oct-2-enyl] methyl carbonate.
| Compound Name | [(E,5R,7R)-5-hydroxy-7-[(2-methylpropan-2-yl)oxycarbonylamino]oct-2-enyl] methyl carbonate |
|---|---|
| PubChem CID | 25231925 |
| Molecular Formula | C15H27NO6 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | [(E,5R,7R)-5-hydroxy-7-[(2-methylpropan-2-yl)oxycarbonylamino]oct-2-enyl] methyl carbonate |
| SMILES | COC(=O)OC/C=C/C[C@@H](O)C[C@@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27NO6/c1-11(16-13(18)22-15(2,3)4)10-12(17)8-6-7-9-21-14(19)20-5/h6-7,11-12,17H,8-10H2,1-5H3,(H,16,18)/b7-6+/t11-,12-/m1/s1 |
| InChIKey | VHFQJQVJMUMFMO-BYAJROORSA-N |
| XLogP | 2.38 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|