C18H22Cl3NO4 — CID 102363813
[(E)-5-[(2-methylpropan-2-yl)oxycarbonyloxy]-1-phenylpent-3-enyl] 2,2,2-trichloroethanimidate (PubChem CID 102363813) has the molecular formula C18H22Cl3NO4 and a molecular weight of 422.74 g/mol. Its IUPAC name is [(E)-5-[(2-methylpropan-2-yl)oxycarbonyloxy]-1-phenylpent-3-enyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(E)-5-[(2-methylpropan-2-yl)oxycarbonyloxy]-1-phenylpent-3-enyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 102363813 |
| Molecular Formula | C18H22Cl3NO4 |
| Molecular Weight | 422.74 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | [(E)-5-[(2-methylpropan-2-yl)oxycarbonyloxy]-1-phenylpent-3-enyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC(C/C=C/COC(=O)OC(C)(C)C)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H22Cl3NO4/c1-17(2,3)26-16(23)24-12-8-7-11-14(13-9-5-4-6-10-13)25-15(22)18(19,20)21/h4-10,14,22H,11-12H2,1-3H3/b8-7+,22-15+ |
| InChIKey | DNSUDCFFBAGKIQ-MEBAUOSVSA-N |
| XLogP | 5.99 |
| TPSA | 68.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.74 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|