C14H15F3O3 — CID 122223212
tert-butyl (2,3,3-trifluoro-1-phenylprop-2-enyl) carbonate (PubChem CID 122223212) has the molecular formula C14H15F3O3 and a molecular weight of 288.26 g/mol. Its IUPAC name is tert-butyl (2,3,3-trifluoro-1-phenylprop-2-enyl) carbonate.
| Compound Name | tert-butyl (2,3,3-trifluoro-1-phenylprop-2-enyl) carbonate |
|---|---|
| PubChem CID | 122223212 |
| Molecular Formula | C14H15F3O3 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | tert-butyl (2,3,3-trifluoro-1-phenylprop-2-enyl) carbonate |
| SMILES | CC(C)(C)OC(=O)OC(C(F)=C(F)F)c1ccccc1 |
| InChI | InChI=1S/C14H15F3O3/c1-14(2,3)20-13(18)19-11(10(15)12(16)17)9-7-5-4-6-8-9/h4-8,11H,1-3H3 |
| InChIKey | YSEJBFCJSBPBBU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |