C19H25FO5 — CID 135077028
tert-butyl 2-[(2-fluorophenyl)-[(2-methylpropan-2-yl)oxycarbonyloxy]methyl]prop-2-enoate (PubChem CID 135077028) has the molecular formula C19H25FO5 and a molecular weight of 352.40 g/mol. Its IUPAC name is tert-butyl 2-[(2-fluorophenyl)-[(2-methylpropan-2-yl)oxycarbonyloxy]methyl]prop-2-enoate.
| Compound Name | tert-butyl 2-[(2-fluorophenyl)-[(2-methylpropan-2-yl)oxycarbonyloxy]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 135077028 |
| Molecular Formula | C19H25FO5 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | tert-butyl 2-[(2-fluorophenyl)-[(2-methylpropan-2-yl)oxycarbonyloxy]methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC(C)(C)C)C(OC(=O)OC(C)(C)C)c1ccccc1F |
| InChI | InChI=1S/C19H25FO5/c1-12(16(21)24-18(2,3)4)15(13-10-8-9-11-14(13)20)23-17(22)25-19(5,6)7/h8-11,15H,1H2,2-7H3 |
| InChIKey | IFAXOJWFSDEISS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|