C17H22O5 — CID 53382208
tert-butyl [1-(2-methoxyphenyl)-2-methylidene-3-oxobutyl] carbonate (PubChem CID 53382208) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is tert-butyl [1-(2-methoxyphenyl)-2-methylidene-3-oxobutyl] carbonate.
| Compound Name | tert-butyl [1-(2-methoxyphenyl)-2-methylidene-3-oxobutyl] carbonate |
|---|---|
| PubChem CID | 53382208 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | tert-butyl [1-(2-methoxyphenyl)-2-methylidene-3-oxobutyl] carbonate |
| SMILES | C=C(C(C)=O)C(OC(=O)OC(C)(C)C)c1ccccc1OC |
| InChI | InChI=1S/C17H22O5/c1-11(12(2)18)15(21-16(19)22-17(3,4)5)13-9-7-8-10-14(13)20-6/h7-10,15H,1H2,2-6H3 |
| InChIKey | JOXNRHPDLYIXST-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|