C24H24NO2PS — CID 23643632
3-[(diphenylphosphinothioylamino)-(2-methoxyphenyl)methyl]but-3-en-2-one (PubChem CID 23643632) has the molecular formula C24H24NO2PS and a molecular weight of 421.50 g/mol. Its IUPAC name is 3-[(diphenylphosphinothioylamino)-(2-methoxyphenyl)methyl]but-3-en-2-one.
| Compound Name | 3-[(diphenylphosphinothioylamino)-(2-methoxyphenyl)methyl]but-3-en-2-one |
|---|---|
| PubChem CID | 23643632 |
| Molecular Formula | C24H24NO2PS |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 3-[(diphenylphosphinothioylamino)-(2-methoxyphenyl)methyl]but-3-en-2-one |
| SMILES | C=C(C(C)=O)C(NP(=S)(c1ccccc1)c1ccccc1)c1ccccc1OC |
| InChI | InChI=1S/C24H24NO2PS/c1-18(19(2)26)24(22-16-10-11-17-23(22)27-3)25-28(29,20-12-6-4-7-13-20)21-14-8-5-9-15-21/h4-17,24H,1H2,2-3H3,(H,25,29) |
| InChIKey | JYAVDACJAIHFAT-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|