C13H15NO5 — CID 89206089
2-(2-methoxyphenyl)-2-(prop-1-en-2-yloxycarbonylamino)acetic acid (PubChem CID 89206089) has the molecular formula C13H15NO5 and a molecular weight of 265.27 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-2-(prop-1-en-2-yloxycarbonylamino)acetic acid.
| Compound Name | 2-(2-methoxyphenyl)-2-(prop-1-en-2-yloxycarbonylamino)acetic acid |
|---|---|
| PubChem CID | 89206089 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 2-(2-methoxyphenyl)-2-(prop-1-en-2-yloxycarbonylamino)acetic acid |
| SMILES | C=C(C)OC(=O)NC(C(=O)O)c1ccccc1OC |
| InChI | InChI=1S/C13H15NO5/c1-8(2)19-13(17)14-11(12(15)16)9-6-4-5-7-10(9)18-3/h4-7,11H,1H2,2-3H3,(H,14,17)(H,15,16) |
| InChIKey | HDUBQZGLHUXIGV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|