C16H23NO4 — CID 134944637
tert-butyl N-methoxy-N-[(1R)-1-(2-methoxyphenyl)prop-2-enyl]carbamate (PubChem CID 134944637) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is tert-butyl N-methoxy-N-[(1R)-1-(2-methoxyphenyl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-methoxy-N-[(1R)-1-(2-methoxyphenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 134944637 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | tert-butyl N-methoxy-N-[(1R)-1-(2-methoxyphenyl)prop-2-enyl]carbamate |
| SMILES | C=C[C@H](c1ccccc1OC)N(OC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H23NO4/c1-7-13(12-10-8-9-11-14(12)19-5)17(20-6)15(18)21-16(2,3)4/h7-11,13H,1H2,2-6H3/t13-/m1/s1 |
| InChIKey | BRLAPMUPFNPBLI-CYBMUJFWSA-N |
| XLogP | 3.72 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|