C42H49N3O6 — CID 25185507
tert-butyl N-[N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]-N-[(1S)-1-naphthalen-1-ylprop-2-enyl]carbamimidoyl]-N-[(1S)-1-naphthalen-1-ylprop-2-enyl]carbamate (PubChem CID 25185507) has the molecular formula C42H49N3O6 and a molecular weight of 691.87 g/mol. Its IUPAC name is tert-butyl N-[N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]-N-[(1S)-1-naphthalen-1-ylprop-2-enyl]carbamimidoyl]-N-[(1S)-1-naphthalen-1-ylprop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]-N-[(1S)-1-naphthalen-1-ylprop-2-enyl]carbamimidoyl]-N-[(1S)-1-naphthalen-1-ylprop-2-enyl]carbamate |
|---|---|
| PubChem CID | 25185507 |
| Molecular Formula | C42H49N3O6 |
| Molecular Weight | 691.87 g/mol |
| Exact Mass | 691.36 |
| IUPAC Name | tert-butyl N-[N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]-N-[(1S)-1-naphthalen-1-ylprop-2-enyl]carbamimidoyl]-N-[(1S)-1-naphthalen-1-ylprop-2-enyl]carbamate |
| SMILES | C=C[C@@H](c1cccc2ccccc12)N(C(=O)OC(C)(C)C)C(=NC(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)[C@@H](C=C)c1cccc2ccccc12 |
| InChI | InChI=1S/C42H49N3O6/c1-12-34(32-26-18-22-28-20-14-16-24-30(28)32)44(38(47)50-41(6,7)8)36(43-37(46)49-40(3,4)5)45(39(48)51-42(9,10)11)35(13-2)33-27-19-23-29-21-15-17-25-31(29)33/h12-27,34-35H,1-2H2,3-11H3/t34-,35-/m0/s1 |
| InChIKey | HRNBNPIPHRMXHM-PXLJZGITSA-N |
| XLogP | 10.91 |
| TPSA | 97.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.87 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|