C16H18O3 — CID 174374928
tert-butyl (2R)-2-hydroxy-2-naphthalen-1-ylacetate (PubChem CID 174374928) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is tert-butyl (2R)-2-hydroxy-2-naphthalen-1-ylacetate.
| Compound Name | tert-butyl (2R)-2-hydroxy-2-naphthalen-1-ylacetate |
|---|---|
| PubChem CID | 174374928 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | tert-butyl (2R)-2-hydroxy-2-naphthalen-1-ylacetate |
| SMILES | CC(C)(C)OC(=O)[C@H](O)c1cccc2ccccc12 |
| InChI | InChI=1S/C16H18O3/c1-16(2,3)19-15(18)14(17)13-10-6-8-11-7-4-5-9-12(11)13/h4-10,14,17H,1-3H3/t14-/m1/s1 |
| InChIKey | QMTAFSZJFZWUBH-CQSZACIVSA-N |
| XLogP | 3.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |