About tert-butyl (2R,3S)-3-hydroxy-2-methyl-3-naphthalen-1-yl-2-(phenylsulfanylmethyl)propanoate
tert-butyl (2R,3S)-3-hydroxy-2-methyl-3-naphthalen-1-yl-2-(phenylsulfanylmethyl)propanoate (PubChem CID 100941185) has the molecular formula C25H28O3S
and a molecular weight of 408.56 g/mol. Its IUPAC name is tert-butyl (2R,3S)-3-hydroxy-2-methyl-3-naphthalen-1-yl-2-(phenylsulfanylmethyl)propanoate.
Molecular Properties
| Compound Name | tert-butyl (2R,3S)-3-hydroxy-2-methyl-3-naphthalen-1-yl-2-(phenylsulfanylmethyl)propanoate |
| PubChem CID | 100941185 |
| Molecular Formula | C25H28O3S |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | tert-butyl (2R,3S)-3-hydroxy-2-methyl-3-naphthalen-1-yl-2-(phenylsulfanylmethyl)propanoate |
| SMILES | CC(C)(C)OC(=O)[C@](C)(CSc1ccccc1)[C@@H](O)c1cccc2ccccc12 |
| InChI | InChI=1S/C25H28O3S/c1-24(2,3)28-23(27)25(4,17-29-19-13-6-5-7-14-19)22(26)21-16-10-12-18-11-8-9-15-20(18)21/h5-16,22,26H,17H2,1-4H3/t22-,25+/m0/s1 |
| InChIKey | HYNWFGVRBVHZGJ-WIOPSUGQSA-N |
| XLogP | 6.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl (2R,3S)-3-hydroxy-2-methyl-3-naphthalen-1-yl-2-(phenylsulfanylmethyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2R,3S)-3-hydroxy-2-methyl-3-naphthalen-1-yl-2-(phenylsulfanylmethyl)propanoate?
The IUPAC name of tert-butyl (2R,3S)-3-hydroxy-2-methyl-3-naphthalen-1-yl-2-(phenylsulfanylmethyl)propanoate (CID 100941185) is tert-butyl (2R,3S)-3-hydroxy-2-methyl-3-naphthalen-1-yl-2-(phenylsulfanylmethyl)propanoate.
What is the SMILES notation for tert-butyl (2R,3S)-3-hydroxy-2-methyl-3-naphthalen-1-yl-2-(phenylsulfanylmethyl)propanoate?
The canonical SMILES for tert-butyl (2R,3S)-3-hydroxy-2-methyl-3-naphthalen-1-yl-2-(phenylsulfanylmethyl)propanoate is CC(C)(C)OC(=O)[C@](C)(CSc1ccccc1)[C@@H](O)c1cccc2ccccc12.
What is the InChIKey of tert-butyl (2R,3S)-3-hydroxy-2-methyl-3-naphthalen-1-yl-2-(phenylsulfanylmethyl)propanoate?
The InChIKey is HYNWFGVRBVHZGJ-WIOPSUGQSA-N. The full InChI is InChI=1S/C25H28O3S/c1-24(2,3)28-23(27)25(4,17-29-19-13-6-5-7-14-19)22(26)21-16-10-12-18-11-8-9-15-20(18)21/h5-16,22,26H,17H2,1-4H3/t22-,25+/m0/s1.
What are the key properties of tert-butyl (2R,3S)-3-hydroxy-2-methyl-3-naphthalen-1-yl-2-(phenylsulfanylmethyl)propanoate?
tert-butyl (2R,3S)-3-hydroxy-2-methyl-3-naphthalen-1-yl-2-(phenylsulfanylmethyl)propanoate has a molecular weight of 408.56 g/mol, XLogP of 6.01, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2R,3S)-3-hydroxy-2-methyl-3-naphthalen-1-yl-2-(phenylsulfanylmethyl)propanoate is sourced from PubChem (CID 100941185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).