C25H24O3 — CID 101476199
tert-butyl (2S,3R)-2-hydroxy-2-naphthalen-1-yl-3-phenylpent-4-ynoate (PubChem CID 101476199) has the molecular formula C25H24O3 and a molecular weight of 372.46 g/mol. Its IUPAC name is tert-butyl (2S,3R)-2-hydroxy-2-naphthalen-1-yl-3-phenylpent-4-ynoate.
| Compound Name | tert-butyl (2S,3R)-2-hydroxy-2-naphthalen-1-yl-3-phenylpent-4-ynoate |
|---|---|
| PubChem CID | 101476199 |
| Molecular Formula | C25H24O3 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | tert-butyl (2S,3R)-2-hydroxy-2-naphthalen-1-yl-3-phenylpent-4-ynoate |
| SMILES | C#C[C@H](c1ccccc1)[C@@](O)(C(=O)OC(C)(C)C)c1cccc2ccccc12 |
| InChI | InChI=1S/C25H24O3/c1-5-21(19-13-7-6-8-14-19)25(27,23(26)28-24(2,3)4)22-17-11-15-18-12-9-10-16-20(18)22/h1,6-17,21,27H,2-4H3/t21-,25+/m1/s1 |
| InChIKey | MGQYFPDFVBEAIP-BWKNWUBXSA-N |
| XLogP | 4.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|