C25H32O4Si — CID 101476205
tert-butyl (2S,3R)-2-hydroxy-2-(4-methoxyphenyl)-3-phenyl-5-trimethylsilylpent-4-ynoate (PubChem CID 101476205) has the molecular formula C25H32O4Si and a molecular weight of 424.61 g/mol. Its IUPAC name is tert-butyl (2S,3R)-2-hydroxy-2-(4-methoxyphenyl)-3-phenyl-5-trimethylsilylpent-4-ynoate.
| Compound Name | tert-butyl (2S,3R)-2-hydroxy-2-(4-methoxyphenyl)-3-phenyl-5-trimethylsilylpent-4-ynoate |
|---|---|
| PubChem CID | 101476205 |
| Molecular Formula | C25H32O4Si |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | tert-butyl (2S,3R)-2-hydroxy-2-(4-methoxyphenyl)-3-phenyl-5-trimethylsilylpent-4-ynoate |
| SMILES | COc1ccc([C@](O)(C(=O)OC(C)(C)C)[C@@H](C#C[Si](C)(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H32O4Si/c1-24(2,3)29-23(26)25(27,20-13-15-21(28-4)16-14-20)22(17-18-30(5,6)7)19-11-9-8-10-12-19/h8-16,22,27H,1-7H3/t22-,25+/m0/s1 |
| InChIKey | CLPPEVHFVWVSAC-WIOPSUGQSA-N |
| XLogP | 4.89 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|