C29H26O5 — CID 3480592
benzhydryl 2-hydroxy-2,2-bis(4-methoxyphenyl)acetate (PubChem CID 3480592) has the molecular formula C29H26O5 and a molecular weight of 454.52 g/mol. Its IUPAC name is benzhydryl 2-hydroxy-2,2-bis(4-methoxyphenyl)acetate.
| Compound Name | benzhydryl 2-hydroxy-2,2-bis(4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 3480592 |
| Molecular Formula | C29H26O5 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | benzhydryl 2-hydroxy-2,2-bis(4-methoxyphenyl)acetate |
| SMILES | COc1ccc(C(O)(C(=O)OC(c2ccccc2)c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H26O5/c1-32-25-17-13-23(14-18-25)29(31,24-15-19-26(33-2)20-16-24)28(30)34-27(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-20,27,31H,1-2H3 |
| InChIKey | AHLHSOZJUUFVFB-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |