C24H25NO3 — CID 24834806
[2-(dimethylamino)-1-phenylethyl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 24834806) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is [2-(dimethylamino)-1-phenylethyl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [2-(dimethylamino)-1-phenylethyl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 24834806 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | [2-(dimethylamino)-1-phenylethyl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | CN(C)CC(OC(=O)C(O)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H25NO3/c1-25(2)18-22(19-12-6-3-7-13-19)28-23(26)24(27,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-17,22,27H,18H2,1-2H3 |
| InChIKey | DLCLQPSAMLSUDP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |