C13H21NO — CID 14962367
(2R,3R)-4-(dimethylamino)-3-methyl-2-phenylbutan-2-ol (PubChem CID 14962367) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (2R,3R)-4-(dimethylamino)-3-methyl-2-phenylbutan-2-ol.
| Compound Name | (2R,3R)-4-(dimethylamino)-3-methyl-2-phenylbutan-2-ol |
|---|---|
| PubChem CID | 14962367 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (2R,3R)-4-(dimethylamino)-3-methyl-2-phenylbutan-2-ol |
| SMILES | C[C@H](CN(C)C)[C@@](C)(O)c1ccccc1 |
| InChI | InChI=1S/C13H21NO/c1-11(10-14(3)4)13(2,15)12-8-6-5-7-9-12/h5-9,11,15H,10H2,1-4H3/t11-,13-/m1/s1 |
| InChIKey | VSWBVLGQKOKQKB-DGCLKSJQSA-N |
| XLogP | 2.09 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |