C19H25NO — CID 87815163
(2S,3R)-3-deuteriooxy-N,N,2-trimethyl-3,4-diphenylbutan-1-amine (PubChem CID 87815163) has the molecular formula C19H25NO and a molecular weight of 284.42 g/mol. Its IUPAC name is (2S,3R)-3-deuteriooxy-N,N,2-trimethyl-3,4-diphenylbutan-1-amine.
| Compound Name | (2S,3R)-3-deuteriooxy-N,N,2-trimethyl-3,4-diphenylbutan-1-amine |
|---|---|
| PubChem CID | 87815163 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | (2S,3R)-3-deuteriooxy-N,N,2-trimethyl-3,4-diphenylbutan-1-amine |
| SMILES | [2H]O[C@@](Cc1ccccc1)(c1ccccc1)[C@@H](C)CN(C)C |
| InChI | InChI=1S/C19H25NO/c1-16(15-20(2)3)19(21,18-12-8-5-9-13-18)14-17-10-6-4-7-11-17/h4-13,16,21H,14-15H2,1-3H3/t16-,19+/m0/s1/i21D |
| InChIKey | INTCGJHAECYOBW-UXVLVDNSSA-N |
| XLogP | 3.31 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |