C24H28ClNO — CID 117067679
2-benzyl-3-(dimethylamino)-1,1-diphenylpropan-1-ol;hydrochloride (PubChem CID 117067679) has the molecular formula C24H28ClNO and a molecular weight of 381.95 g/mol. Its IUPAC name is 2-benzyl-3-(dimethylamino)-1,1-diphenylpropan-1-ol;hydrochloride.
| Compound Name | 2-benzyl-3-(dimethylamino)-1,1-diphenylpropan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 117067679 |
| Molecular Formula | C24H28ClNO |
| Molecular Weight | 381.95 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 2-benzyl-3-(dimethylamino)-1,1-diphenylpropan-1-ol;hydrochloride |
| SMILES | CN(C)CC(Cc1ccccc1)C(O)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C24H27NO.ClH/c1-25(2)19-23(18-20-12-6-3-7-13-20)24(26,21-14-8-4-9-15-21)22-16-10-5-11-17-22;/h3-17,23,26H,18-19H2,1-2H3;1H |
| InChIKey | CDULBLOBQIFEAK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.95 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |