C21H22NO+ — CID 7023047
[(2S)-1-hydroxy-1,1,3-triphenylpropan-2-yl]azanium (PubChem CID 7023047) has the molecular formula C21H22NO+ and a molecular weight of 304.41 g/mol. Its IUPAC name is [(2S)-1-hydroxy-1,1,3-triphenylpropan-2-yl]azanium.
| Compound Name | [(2S)-1-hydroxy-1,1,3-triphenylpropan-2-yl]azanium |
|---|---|
| PubChem CID | 7023047 |
| Molecular Formula | C21H22NO+ |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | [(2S)-1-hydroxy-1,1,3-triphenylpropan-2-yl]azanium |
| SMILES | [NH3+][C@@H](Cc1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H21NO/c22-20(16-17-10-4-1-5-11-17)21(23,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15,20,23H,16,22H2/p+1/t20-/m0/s1 |
| InChIKey | KBXBDYRXZGBOIH-FQEVSTJZSA-O |
| XLogP | 2.78 |
| TPSA | 47.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |