C15H18Si — CID 123615026
1,3-diphenylpropan-2-ylsilane (PubChem CID 123615026) has the molecular formula C15H18Si and a molecular weight of 226.40 g/mol. Its IUPAC name is 1,3-diphenylpropan-2-ylsilane.
| Compound Name | 1,3-diphenylpropan-2-ylsilane |
|---|---|
| PubChem CID | 123615026 |
| Molecular Formula | C15H18Si |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 1,3-diphenylpropan-2-ylsilane |
| SMILES | [SiH3]C(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C15H18Si/c16-15(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10,15H,11-12H2,16H3 |
| InChIKey | YIKHZGIQRWZTBN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|