C8H14Cl2N2 — CID 90190453
2-phenylethane-1,1-diamine;dihydrochloride (PubChem CID 90190453) has the molecular formula C8H14Cl2N2 and a molecular weight of 209.12 g/mol. Its IUPAC name is 2-phenylethane-1,1-diamine;dihydrochloride.
| Compound Name | 2-phenylethane-1,1-diamine;dihydrochloride |
|---|---|
| PubChem CID | 90190453 |
| Molecular Formula | C8H14Cl2N2 |
| Molecular Weight | 209.12 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 2-phenylethane-1,1-diamine;dihydrochloride |
| SMILES | Cl.Cl.NC(N)Cc1ccccc1 |
| InChI | InChI=1S/C8H12N2.2ClH/c9-8(10)6-7-4-2-1-3-5-7;;/h1-5,8H,6,9-10H2;2*1H |
| InChIKey | NXDOGGHVOFGMGP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.12 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|