About Darvon
Darvon (PubChem CID 15329) has the molecular formula C22H30ClNO2
and a molecular weight of 375.90 g/mol. Its IUPAC name is [4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-yl] propanoate;hydrochloride.
Molecular Properties
| Compound Name | Darvon |
| PubChem CID | 15329 |
| Molecular Formula | C22H30ClNO2 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | [4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-yl] propanoate;hydrochloride |
| SMILES | CCC(=O)OC(CC1=CC=CC=C1)(C2=CC=CC=C2)C(C)CN(C)C.Cl |
| InChI | InChI=1S/C22H29NO2.ClH/c1-5-21(24)25-22(18(2)17-23(3)4,20-14-10-7-11-15-20)16-19-12-8-6-9-13-19;/h6-15,18H,5,16-17H2,1-4H3;1H |
| InChIKey | QMQBBUPJKANITL-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 29.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | 397 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Darvon with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Darvon?
The IUPAC name of Darvon (CID 15329) is [4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-yl] propanoate;hydrochloride.
What is the SMILES notation for Darvon?
The canonical SMILES for Darvon is CCC(=O)OC(CC1=CC=CC=C1)(C2=CC=CC=C2)C(C)CN(C)C.Cl.
What is the InChIKey of Darvon?
The InChIKey is QMQBBUPJKANITL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29NO2.ClH/c1-5-21(24)25-22(18(2)17-23(3)4,20-14-10-7-11-15-20)16-19-12-8-6-9-13-19;/h6-15,18H,5,16-17H2,1-4H3;1H.
What are the key properties of Darvon?
Darvon has a molecular weight of 375.90 g/mol, XLogP of not available, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Darvon is sourced from PubChem (CID 15329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).