C20H27NO4 — CID 173385557
1-(dimethylamino)propan-2-ol;2-methoxy-2,2-diphenylacetic acid (PubChem CID 173385557) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is 1-(dimethylamino)propan-2-ol;2-methoxy-2,2-diphenylacetic acid.
| Compound Name | 1-(dimethylamino)propan-2-ol;2-methoxy-2,2-diphenylacetic acid |
|---|---|
| PubChem CID | 173385557 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 1-(dimethylamino)propan-2-ol;2-methoxy-2,2-diphenylacetic acid |
| SMILES | CC(O)CN(C)C.COC(C(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H14O3.C5H13NO/c1-18-15(14(16)17,12-8-4-2-5-9-12)13-10-6-3-7-11-13;1-5(7)4-6(2)3/h2-11H,1H3,(H,16,17);5,7H,4H2,1-3H3 |
| InChIKey | XBWAEORNTJPKSB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |