C27H36N2O2 — CID 175330343
6-(dimethylamino)-5-methyl-4,4-diphenylhexan-3-one;methanol;pyridine (PubChem CID 175330343) has the molecular formula C27H36N2O2 and a molecular weight of 420.60 g/mol. Its IUPAC name is 6-(dimethylamino)-5-methyl-4,4-diphenylhexan-3-one;methanol;pyridine.
| Compound Name | 6-(dimethylamino)-5-methyl-4,4-diphenylhexan-3-one;methanol;pyridine |
|---|---|
| PubChem CID | 175330343 |
| Molecular Formula | C27H36N2O2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | 6-(dimethylamino)-5-methyl-4,4-diphenylhexan-3-one;methanol;pyridine |
| SMILES | CCC(=O)C(c1ccccc1)(c1ccccc1)C(C)CN(C)C.CO.c1ccncc1 |
| InChI | InChI=1S/C21H27NO.C5H5N.CH4O/c1-5-20(23)21(17(2)16-22(3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19;1-2-4-6-5-3-1;1-2/h6-15,17H,5,16H2,1-4H3;1-5H;2H,1H3 |
| InChIKey | CJPCGMMMLFUSNE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |