C22H27N2O4+ — CID 164732610
methylidene-[(2R)-2-methyl-4-oxo-3,3-diphenylhexyl]-(2-nitrooxyethyl)azanium (PubChem CID 164732610) has the molecular formula C22H27N2O4+ and a molecular weight of 383.47 g/mol. Its IUPAC name is methylidene-[(2R)-2-methyl-4-oxo-3,3-diphenylhexyl]-(2-nitrooxyethyl)azanium.
| Compound Name | methylidene-[(2R)-2-methyl-4-oxo-3,3-diphenylhexyl]-(2-nitrooxyethyl)azanium |
|---|---|
| PubChem CID | 164732610 |
| Molecular Formula | C22H27N2O4+ |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | methylidene-[(2R)-2-methyl-4-oxo-3,3-diphenylhexyl]-(2-nitrooxyethyl)azanium |
| SMILES | C=[N+](CCO[N+](=O)[O-])C[C@H](C)C(C(=O)CC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H27N2O4/c1-4-21(25)22(19-11-7-5-8-12-19,20-13-9-6-10-14-20)18(2)17-23(3)15-16-28-24(26)27/h5-14,18H,3-4,15-17H2,1-2H3/q+1/t18-/m0/s1 |
| InChIKey | ZHKIPDRZUILOFH-SFHVURJKSA-N |
| XLogP | 3.51 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|