C9H11NO4 — CID 67839406
2-nitro-1-phenylpropane-1,1-diol (PubChem CID 67839406) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is 2-nitro-1-phenylpropane-1,1-diol.
| Compound Name | 2-nitro-1-phenylpropane-1,1-diol |
|---|---|
| PubChem CID | 67839406 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 2-nitro-1-phenylpropane-1,1-diol |
| SMILES | CC([N+](=O)[O-])C(O)(O)c1ccccc1 |
| InChI | InChI=1S/C9H11NO4/c1-7(10(13)14)9(11,12)8-5-3-2-4-6-8/h2-7,11-12H,1H3 |
| InChIKey | IUMFEJKVIQWHCQ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|