C26H21NO2 — CID 134984287
(1-nitro-2,2,2-triphenylethyl)benzene (PubChem CID 134984287) has the molecular formula C26H21NO2 and a molecular weight of 379.46 g/mol. Its IUPAC name is (1-nitro-2,2,2-triphenylethyl)benzene.
| Compound Name | (1-nitro-2,2,2-triphenylethyl)benzene |
|---|---|
| PubChem CID | 134984287 |
| Molecular Formula | C26H21NO2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | (1-nitro-2,2,2-triphenylethyl)benzene |
| SMILES | O=[N+]([O-])C(c1ccccc1)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H21NO2/c28-27(29)25(21-13-5-1-6-14-21)26(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20,25H |
| InChIKey | ZADHLAKJJQFJAG-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|