C12H16BrNO3 — CID 88654152
1-bromo-3,3-dimethyl-4-nitro-4-phenylbutan-2-ol (PubChem CID 88654152) has the molecular formula C12H16BrNO3 and a molecular weight of 302.17 g/mol. Its IUPAC name is 1-bromo-3,3-dimethyl-4-nitro-4-phenylbutan-2-ol.
| Compound Name | 1-bromo-3,3-dimethyl-4-nitro-4-phenylbutan-2-ol |
|---|---|
| PubChem CID | 88654152 |
| Molecular Formula | C12H16BrNO3 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 1-bromo-3,3-dimethyl-4-nitro-4-phenylbutan-2-ol |
| SMILES | CC(C)(C(O)CBr)C(c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C12H16BrNO3/c1-12(2,10(15)8-13)11(14(16)17)9-6-4-3-5-7-9/h3-7,10-11,15H,8H2,1-2H3 |
| InChIKey | JJGPSEWFEGHSTK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|