C10H13NO3 — CID 102161516
(2R,3R)-1-nitro-3-phenylbutan-2-ol (PubChem CID 102161516) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is (2R,3R)-1-nitro-3-phenylbutan-2-ol.
| Compound Name | (2R,3R)-1-nitro-3-phenylbutan-2-ol |
|---|---|
| PubChem CID | 102161516 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | (2R,3R)-1-nitro-3-phenylbutan-2-ol |
| SMILES | C[C@H](c1ccccc1)[C@@H](O)C[N+](=O)[O-] |
| InChI | InChI=1S/C10H13NO3/c1-8(10(12)7-11(13)14)9-5-3-2-4-6-9/h2-6,8,10,12H,7H2,1H3/t8-,10+/m1/s1 |
| InChIKey | KHUZFEHCQAZADW-SCZZXKLOSA-N |
| XLogP | 1.43 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|