C18H22N2O3 — CID 11964376
(2R,3S)-3-(dibenzylamino)-1-nitrobutan-2-ol (PubChem CID 11964376) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is (2R,3S)-3-(dibenzylamino)-1-nitrobutan-2-ol.
| Compound Name | (2R,3S)-3-(dibenzylamino)-1-nitrobutan-2-ol |
|---|---|
| PubChem CID | 11964376 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | (2R,3S)-3-(dibenzylamino)-1-nitrobutan-2-ol |
| SMILES | C[C@@H]([C@H](O)C[N+](=O)[O-])N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C18H22N2O3/c1-15(18(21)14-20(22)23)19(12-16-8-4-2-5-9-16)13-17-10-6-3-7-11-17/h2-11,15,18,21H,12-14H2,1H3/t15-,18+/m0/s1 |
| InChIKey | PZNDSVASOOSHFP-MAUKXSAKSA-N |
| XLogP | 2.71 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|