C35H41N3O3 — CID 135005966
(2R,3R)-3,7-bis(dibenzylamino)-1-nitroheptan-2-ol (PubChem CID 135005966) has the molecular formula C35H41N3O3 and a molecular weight of 551.73 g/mol. Its IUPAC name is (2R,3R)-3,7-bis(dibenzylamino)-1-nitroheptan-2-ol.
| Compound Name | (2R,3R)-3,7-bis(dibenzylamino)-1-nitroheptan-2-ol |
|---|---|
| PubChem CID | 135005966 |
| Molecular Formula | C35H41N3O3 |
| Molecular Weight | 551.73 g/mol |
| Exact Mass | 551.31 |
| IUPAC Name | (2R,3R)-3,7-bis(dibenzylamino)-1-nitroheptan-2-ol |
| SMILES | O=[N+]([O-])C[C@@H](O)[C@@H](CCCCN(Cc1ccccc1)Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C35H41N3O3/c39-35(29-38(40)41)34(37(27-32-19-9-3-10-20-32)28-33-21-11-4-12-22-33)23-13-14-24-36(25-30-15-5-1-6-16-30)26-31-17-7-2-8-18-31/h1-12,15-22,34-35,39H,13-14,23-29H2/t34-,35-/m1/s1 |
| InChIKey | UATKLMACLXEFBQ-VSJLXWSYSA-N |
| XLogP | 6.57 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.73 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|