C25H30N2O — CID 11337812
(2S,3S)-1-(benzylamino)-3-(dibenzylamino)butan-2-ol (PubChem CID 11337812) has the molecular formula C25H30N2O and a molecular weight of 374.53 g/mol. Its IUPAC name is (2S,3S)-1-(benzylamino)-3-(dibenzylamino)butan-2-ol.
| Compound Name | (2S,3S)-1-(benzylamino)-3-(dibenzylamino)butan-2-ol |
|---|---|
| PubChem CID | 11337812 |
| Molecular Formula | C25H30N2O |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | (2S,3S)-1-(benzylamino)-3-(dibenzylamino)butan-2-ol |
| SMILES | C[C@@H]([C@@H](O)CNCc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H30N2O/c1-21(25(28)18-26-17-22-11-5-2-6-12-22)27(19-23-13-7-3-8-14-23)20-24-15-9-4-10-16-24/h2-16,21,25-26,28H,17-20H2,1H3/t21-,25-/m0/s1 |
| InChIKey | QWSUGMDPCZDVOR-OFVILXPXSA-N |
| XLogP | 4.23 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |