C12H18O3 — CID 132576079
3,3-dimethyl-4-phenylbutane-1,2,4-triol (PubChem CID 132576079) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 3,3-dimethyl-4-phenylbutane-1,2,4-triol.
| Compound Name | 3,3-dimethyl-4-phenylbutane-1,2,4-triol |
|---|---|
| PubChem CID | 132576079 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 3,3-dimethyl-4-phenylbutane-1,2,4-triol |
| SMILES | CC(C)(C(O)CO)C(O)c1ccccc1 |
| InChI | InChI=1S/C12H18O3/c1-12(2,10(14)8-13)11(15)9-6-4-3-5-7-9/h3-7,10-11,13-15H,8H2,1-2H3 |
| InChIKey | BCQZYPJAGZTMFR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |