C24H27NO — CID 12570790
2-(2,2-diphenylethylamino)-2-methyl-1-phenylpropan-1-ol (PubChem CID 12570790) has the molecular formula C24H27NO and a molecular weight of 345.49 g/mol. Its IUPAC name is 2-(2,2-diphenylethylamino)-2-methyl-1-phenylpropan-1-ol.
| Compound Name | 2-(2,2-diphenylethylamino)-2-methyl-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 12570790 |
| Molecular Formula | C24H27NO |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 2-(2,2-diphenylethylamino)-2-methyl-1-phenylpropan-1-ol |
| SMILES | CC(C)(NCC(c1ccccc1)c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C24H27NO/c1-24(2,23(26)21-16-10-5-11-17-21)25-18-22(19-12-6-3-7-13-19)20-14-8-4-9-15-20/h3-17,22-23,25-26H,18H2,1-2H3 |
| InChIKey | TYHUVBODGLIIRZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |