C11H14O4 — CID 13435156
methyl (2S,3S)-2,3-dihydroxy-2-methyl-3-phenylpropanoate (PubChem CID 13435156) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is methyl (2S,3S)-2,3-dihydroxy-2-methyl-3-phenylpropanoate.
| Compound Name | methyl (2S,3S)-2,3-dihydroxy-2-methyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 13435156 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | methyl (2S,3S)-2,3-dihydroxy-2-methyl-3-phenylpropanoate |
| SMILES | COC(=O)[C@@](C)(O)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C11H14O4/c1-11(14,10(13)15-2)9(12)8-6-4-3-5-7-8/h3-7,9,12,14H,1-2H3/t9-,11-/m0/s1 |
| InChIKey | OZYJYYVYBYNROU-ONGXEEELSA-N |
| XLogP | 0.64 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |