About (2S)-2,3-dihydroxy-4-methoxy-3-methyl-4-oxobutanoic acid
(2S)-2,3-dihydroxy-4-methoxy-3-methyl-4-oxobutanoic acid (PubChem CID 175112445) has the molecular formula C6H10O6
and a molecular weight of 178.14 g/mol. Its IUPAC name is (2S)-2,3-dihydroxy-4-methoxy-3-methyl-4-oxobutanoic acid.
Analyze (2S)-2,3-dihydroxy-4-methoxy-3-methyl-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,3-dihydroxy-4-methoxy-3-methyl-4-oxobutanoic acid?
The IUPAC name of (2S)-2,3-dihydroxy-4-methoxy-3-methyl-4-oxobutanoic acid (CID 175112445) is (2S)-2,3-dihydroxy-4-methoxy-3-methyl-4-oxobutanoic acid.
What is the SMILES notation for (2S)-2,3-dihydroxy-4-methoxy-3-methyl-4-oxobutanoic acid?
The canonical SMILES for (2S)-2,3-dihydroxy-4-methoxy-3-methyl-4-oxobutanoic acid is COC(=O)C(C)(O)[C@H](O)C(=O)O.
What is the InChIKey of (2S)-2,3-dihydroxy-4-methoxy-3-methyl-4-oxobutanoic acid?
The InChIKey is SOVGTNXAVHNKEI-HODUVHNASA-N. The full InChI is InChI=1S/C6H10O6/c1-6(11,5(10)12-2)3(7)4(8)9/h3,7,11H,1-2H3,(H,8,9)/t3-,6?/m1/s1.
What are the key properties of (2S)-2,3-dihydroxy-4-methoxy-3-methyl-4-oxobutanoic acid?
(2S)-2,3-dihydroxy-4-methoxy-3-methyl-4-oxobutanoic acid has a molecular weight of 178.14 g/mol, XLogP of -1.64, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,3-dihydroxy-4-methoxy-3-methyl-4-oxobutanoic acid is sourced from PubChem (CID 175112445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).