C17H29NO — CID 63193572
3-(dipropylamino)-2,2-dimethyl-1-phenylpropan-1-ol (PubChem CID 63193572) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is 3-(dipropylamino)-2,2-dimethyl-1-phenylpropan-1-ol.
| Compound Name | 3-(dipropylamino)-2,2-dimethyl-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 63193572 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 3-(dipropylamino)-2,2-dimethyl-1-phenylpropan-1-ol |
| SMILES | CCCN(CCC)CC(C)(C)C(O)c1ccccc1 |
| InChI | InChI=1S/C17H29NO/c1-5-12-18(13-6-2)14-17(3,4)16(19)15-10-8-7-9-11-15/h7-11,16,19H,5-6,12-14H2,1-4H3 |
| InChIKey | QDUVJHVNVLEOMC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |