About nitro(phenyl)methanamine
nitro(phenyl)methanamine (PubChem CID 174706034) has the molecular formula C14H16N4O4
and a molecular weight of 304.31 g/mol. Its IUPAC name is nitro(phenyl)methanamine.
Molecular Properties
| Compound Name | nitro(phenyl)methanamine |
| PubChem CID | 174706034 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | nitro(phenyl)methanamine |
| SMILES | NC(c1ccccc1)[N+](=O)[O-].NC(c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/2C7H8N2O2/c2*8-7(9(10)11)6-4-2-1-3-5-6/h2*1-5,7H,8H2 |
| InChIKey | ZCGUUZSWDGJNHP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitro(phenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitro(phenyl)methanamine?
The IUPAC name of nitro(phenyl)methanamine (CID 174706034) is nitro(phenyl)methanamine.
What is the SMILES notation for nitro(phenyl)methanamine?
The canonical SMILES for nitro(phenyl)methanamine is NC(c1ccccc1)[N+](=O)[O-].NC(c1ccccc1)[N+](=O)[O-].
What is the InChIKey of nitro(phenyl)methanamine?
The InChIKey is ZCGUUZSWDGJNHP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H8N2O2/c2*8-7(9(10)11)6-4-2-1-3-5-6/h2*1-5,7H,8H2.
What are the key properties of nitro(phenyl)methanamine?
nitro(phenyl)methanamine has a molecular weight of 304.31 g/mol, XLogP of 1.84, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for nitro(phenyl)methanamine is sourced from PubChem (CID 174706034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).