C21H16N2O2 — CID 134985139
2-nitro-2,3,3-triphenylpropanenitrile (PubChem CID 134985139) has the molecular formula C21H16N2O2 and a molecular weight of 328.37 g/mol. Its IUPAC name is 2-nitro-2,3,3-triphenylpropanenitrile.
| Compound Name | 2-nitro-2,3,3-triphenylpropanenitrile |
|---|---|
| PubChem CID | 134985139 |
| Molecular Formula | C21H16N2O2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-nitro-2,3,3-triphenylpropanenitrile |
| SMILES | N#CC(c1ccccc1)(C(c1ccccc1)c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C21H16N2O2/c22-16-21(23(24)25,19-14-8-3-9-15-19)20(17-10-4-1-5-11-17)18-12-6-2-7-13-18/h1-15,20H |
| InChIKey | QJHFKJVULXVWDN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|