C8H6Br3NO2 — CID 15311500
(1,2,2-tribromo-2-nitroethyl)benzene (PubChem CID 15311500) has the molecular formula C8H6Br3NO2 and a molecular weight of 387.85 g/mol. Its IUPAC name is (1,2,2-tribromo-2-nitroethyl)benzene.
| Compound Name | (1,2,2-tribromo-2-nitroethyl)benzene |
|---|---|
| PubChem CID | 15311500 |
| Molecular Formula | C8H6Br3NO2 |
| Molecular Weight | 387.85 g/mol |
| Exact Mass | 384.79 |
| IUPAC Name | (1,2,2-tribromo-2-nitroethyl)benzene |
| SMILES | O=[N+]([O-])C(Br)(Br)C(Br)c1ccccc1 |
| InChI | InChI=1S/C8H6Br3NO2/c9-7(8(10,11)12(13)14)6-4-2-1-3-5-6/h1-5,7H |
| InChIKey | ORGSIDHAGUFLIJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.85 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|