C18H16Br2O4 — CID 71345208
2,3-bis[bromo(phenyl)methyl]-2,3-dihydroxybutanedial (PubChem CID 71345208) has the molecular formula C18H16Br2O4 and a molecular weight of 456.13 g/mol. Its IUPAC name is 2,3-bis[bromo(phenyl)methyl]-2,3-dihydroxybutanedial.
| Compound Name | 2,3-bis[bromo(phenyl)methyl]-2,3-dihydroxybutanedial |
|---|---|
| PubChem CID | 71345208 |
| Molecular Formula | C18H16Br2O4 |
| Molecular Weight | 456.13 g/mol |
| Exact Mass | 453.94 |
| IUPAC Name | 2,3-bis[bromo(phenyl)methyl]-2,3-dihydroxybutanedial |
| SMILES | O=CC(O)(C(Br)c1ccccc1)C(O)(C=O)C(Br)c1ccccc1 |
| InChI | InChI=1S/C18H16Br2O4/c19-15(13-7-3-1-4-8-13)17(23,11-21)18(24,12-22)16(20)14-9-5-2-6-10-14/h1-12,15-16,23-24H |
| InChIKey | ZFVYPCNDXKTVJU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.13 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|