C11H12Br2N2O4 — CID 56651777
ethyl N-(2,2-dibromo-2-nitro-1-phenylethyl)carbamate (PubChem CID 56651777) has the molecular formula C11H12Br2N2O4 and a molecular weight of 396.04 g/mol. Its IUPAC name is ethyl N-(2,2-dibromo-2-nitro-1-phenylethyl)carbamate.
| Compound Name | ethyl N-(2,2-dibromo-2-nitro-1-phenylethyl)carbamate |
|---|---|
| PubChem CID | 56651777 |
| Molecular Formula | C11H12Br2N2O4 |
| Molecular Weight | 396.04 g/mol |
| Exact Mass | 393.92 |
| IUPAC Name | ethyl N-(2,2-dibromo-2-nitro-1-phenylethyl)carbamate |
| SMILES | CCOC(=O)NC(c1ccccc1)C(Br)(Br)[N+](=O)[O-] |
| InChI | InChI=1S/C11H12Br2N2O4/c1-2-19-10(16)14-9(11(12,13)15(17)18)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H,14,16) |
| InChIKey | JVQCSUJHOAGYTK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.04 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|