C14H9Br4NO2 — CID 4025193
1-nitro-4-(1,1,2,2-tetrabromo-2-phenylethyl)benzene (PubChem CID 4025193) has the molecular formula C14H9Br4NO2 and a molecular weight of 542.85 g/mol. Its IUPAC name is 1-nitro-4-(1,1,2,2-tetrabromo-2-phenylethyl)benzene.
| Compound Name | 1-nitro-4-(1,1,2,2-tetrabromo-2-phenylethyl)benzene |
|---|---|
| PubChem CID | 4025193 |
| Molecular Formula | C14H9Br4NO2 |
| Molecular Weight | 542.85 g/mol |
| Exact Mass | 538.74 |
| IUPAC Name | 1-nitro-4-(1,1,2,2-tetrabromo-2-phenylethyl)benzene |
| SMILES | O=[N+]([O-])c1ccc(C(Br)(Br)C(Br)(Br)c2ccccc2)cc1 |
| InChI | InChI=1S/C14H9Br4NO2/c15-13(16,10-4-2-1-3-5-10)14(17,18)11-6-8-12(9-7-11)19(20)21/h1-9H |
| InChIKey | XKMAIECBUQTOOO-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.85 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|