About 4-nitro-N-tritylaniline
4-nitro-N-tritylaniline (PubChem CID 30004) has the molecular formula C25H20N2O2
and a molecular weight of 380.45 g/mol. Its IUPAC name is 4-nitro-N-tritylaniline.
Molecular Properties
| Compound Name | 4-nitro-N-tritylaniline |
| PubChem CID | 30004 |
| Molecular Formula | C25H20N2O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 4-nitro-N-tritylaniline |
| SMILES | O=[N+]([O-])c1ccc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H20N2O2/c28-27(29)24-18-16-23(17-19-24)26-25(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-19,26H |
| InChIKey | PXOZRBGGHQEYRJ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-N-tritylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-N-tritylaniline?
The IUPAC name of 4-nitro-N-tritylaniline (CID 30004) is 4-nitro-N-tritylaniline.
What is the SMILES notation for 4-nitro-N-tritylaniline?
The canonical SMILES for 4-nitro-N-tritylaniline is O=[N+]([O-])c1ccc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 4-nitro-N-tritylaniline?
The InChIKey is PXOZRBGGHQEYRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20N2O2/c28-27(29)24-18-16-23(17-19-24)26-25(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-19,26H.
What are the key properties of 4-nitro-N-tritylaniline?
4-nitro-N-tritylaniline has a molecular weight of 380.45 g/mol, XLogP of 6.00, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-N-tritylaniline is sourced from PubChem (CID 30004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).