C34H26N4O6 — CID 5091426
4-nitro-N-[4-[1-[4-[(4-nitrobenzoyl)amino]phenyl]-1-phenylethyl]phenyl]benzamide (PubChem CID 5091426) has the molecular formula C34H26N4O6 and a molecular weight of 586.60 g/mol. Its IUPAC name is 4-nitro-N-[4-[1-[4-[(4-nitrobenzoyl)amino]phenyl]-1-phenylethyl]phenyl]benzamide.
| Compound Name | 4-nitro-N-[4-[1-[4-[(4-nitrobenzoyl)amino]phenyl]-1-phenylethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 5091426 |
| Molecular Formula | C34H26N4O6 |
| Molecular Weight | 586.60 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | 4-nitro-N-[4-[1-[4-[(4-nitrobenzoyl)amino]phenyl]-1-phenylethyl]phenyl]benzamide |
| SMILES | CC(c1ccccc1)(c1ccc(NC(=O)c2ccc([N+](=O)[O-])cc2)cc1)c1ccc(NC(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C34H26N4O6/c1-34(25-5-3-2-4-6-25,26-11-15-28(16-12-26)35-32(39)23-7-19-30(20-8-23)37(41)42)27-13-17-29(18-14-27)36-33(40)24-9-21-31(22-10-24)38(43)44/h2-22H,1H3,(H,35,39)(H,36,40) |
| InChIKey | BACUEXAYEZZPAL-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.60 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|