C28H21N3O3 — CID 12707557
5-(4-nitrophenyl)-N-trityl-1,3-oxazol-2-amine (PubChem CID 12707557) has the molecular formula C28H21N3O3 and a molecular weight of 447.49 g/mol. Its IUPAC name is 5-(4-nitrophenyl)-N-trityl-1,3-oxazol-2-amine.
| Compound Name | 5-(4-nitrophenyl)-N-trityl-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 12707557 |
| Molecular Formula | C28H21N3O3 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 5-(4-nitrophenyl)-N-trityl-1,3-oxazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc(-c2cnc(NC(c3ccccc3)(c3ccccc3)c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C28H21N3O3/c32-31(33)25-18-16-21(17-19-25)26-20-29-27(34-26)30-28(22-10-4-1-5-11-22,23-12-6-2-7-13-23)24-14-8-3-9-15-24/h1-20H,(H,29,30) |
| InChIKey | RVHHQLVQCJZHDQ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|